C37H47N3O6 — CID 6672441
N'-hydroxy-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 6672441) has the molecular formula C37H47N3O6 and a molecular weight of 629.80 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6672441 |
| Molecular Formula | C37H47N3O6 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | N'-hydroxy-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CN4CCCCC4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1)NO |
| InChI | InChI=1S/C37H47N3O6/c41-26-27-12-14-30(15-13-27)34-23-33(25-40-20-5-2-6-21-40)45-37(46-34)31-18-16-29(17-19-31)32-9-7-8-28(22-32)24-38-35(42)10-3-1-4-11-36(43)39-44/h7-9,12-19,22,33-34,37,41,44H,1-6,10-11,20-21,23-26H2,(H,38,42)(H,39,43)/t33-,34+,37+/m1/s1 |
| InChIKey | AXOXXMNNTGPPHL-VXDAHBTDSA-N |
| XLogP | 5.95 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|