C38H49N3O5 — CID 4143013
6-acetamido-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 4143013) has the molecular formula C38H49N3O5 and a molecular weight of 627.83 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 4143013 |
| Molecular Formula | C38H49N3O5 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | 6-acetamido-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1cccc(-c2cccc(C3OC(CN4CCCCC4)CC(c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C38H49N3O5/c1-28(43)39-19-5-2-4-14-37(44)40-25-30-10-8-11-32(22-30)33-12-9-13-34(23-33)38-45-35(26-41-20-6-3-7-21-41)24-36(46-38)31-17-15-29(27-42)16-18-31/h8-13,15-18,22-23,35-36,38,42H,2-7,14,19-21,24-27H2,1H3,(H,39,43)(H,40,44) |
| InChIKey | VWAOPERRESWHJT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|