C40H53N3O6 — CID 6676620
N-[[3-[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide (PubChem CID 6676620) has the molecular formula C40H53N3O6 and a molecular weight of 671.88 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[[3-[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 6676620 |
| Molecular Formula | C40H53N3O6 |
| Molecular Weight | 671.88 g/mol |
| Exact Mass | 671.39 |
| IUPAC Name | N-[[3-[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1cccc(-c2ccc([C@@H]3O[C@H](CN4CCCCCCC4)C[C@H](c4ccc(CO)cc4)O3)cc2)c1)NO |
| InChI | InChI=1S/C40H53N3O6/c44-29-30-15-17-33(18-16-30)37-26-36(28-43-23-8-4-1-5-9-24-43)48-40(49-37)34-21-19-32(20-22-34)35-12-10-11-31(25-35)27-41-38(45)13-6-2-3-7-14-39(46)42-47/h10-12,15-22,25,36-37,40,44,47H,1-9,13-14,23-24,26-29H2,(H,41,45)(H,42,46)/t36-,37+,40+/m0/s1 |
| InChIKey | BTFWUXQQDKASIJ-OJSGPSSGSA-N |
| XLogP | 7.12 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.88 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|