C44H54N4O6 — CID 3295583
N-[[3-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide (PubChem CID 3295583) has the molecular formula C44H54N4O6 and a molecular weight of 734.94 g/mol. Its IUPAC name is N-[[3-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[[3-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 3295583 |
| Molecular Formula | C44H54N4O6 |
| Molecular Weight | 734.94 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | N-[[3-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1cccc(-c2cccc(C3OC(CN4CCN(Cc5ccccc5)CC4)CC(c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C44H54N4O6/c49-32-34-18-20-36(21-19-34)41-28-40(31-48-24-22-47(23-25-48)30-33-10-4-3-5-11-33)53-44(54-41)39-15-9-14-38(27-39)37-13-8-12-35(26-37)29-45-42(50)16-6-1-2-7-17-43(51)46-52/h3-5,8-15,18-21,26-27,40-41,44,49,52H,1-2,6-7,16-17,22-25,28-32H2,(H,45,50)(H,46,51) |
| InChIKey | DMMVMLYRCIAPJJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.94 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|