C43H52N4O6 — CID 6674901
N-[[2-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide (PubChem CID 6674901) has the molecular formula C43H52N4O6 and a molecular weight of 720.91 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[[2-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 6674901 |
| Molecular Formula | C43H52N4O6 |
| Molecular Weight | 720.91 g/mol |
| Exact Mass | 720.39 |
| IUPAC Name | N-[[2-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CCN(Cc4ccccc4)CC3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C43H52N4O6/c48-31-33-15-17-35(18-16-33)40-27-38(30-47-25-23-46(24-26-47)29-32-9-3-1-4-10-32)52-43(53-40)36-21-19-34(20-22-36)39-12-8-7-11-37(39)28-44-41(49)13-5-2-6-14-42(50)45-51/h1,3-4,7-12,15-22,38,40,43,48,51H,2,5-6,13-14,23-31H2,(H,44,49)(H,45,50)/t38-,40+,43+/m1/s1 |
| InChIKey | SQUQBHHDWWEOCF-ZPRHKEMQSA-N |
| XLogP | 6.28 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.91 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|