C44H54N4O5 — CID 4298893
6-acetamido-N-[[2-[4-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 4298893) has the molecular formula C44H54N4O5 and a molecular weight of 718.94 g/mol. Its IUPAC name is 6-acetamido-N-[[2-[4-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[2-[4-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 4298893 |
| Molecular Formula | C44H54N4O5 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.41 |
| IUPAC Name | 6-acetamido-N-[[2-[4-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccccc1-c1ccc(C2OC(CN3CCN(Cc4ccccc4)CC3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C44H54N4O5/c1-33(50)45-23-9-3-6-14-43(51)46-29-39-12-7-8-13-41(39)36-19-21-38(22-20-36)44-52-40(28-42(53-44)37-17-15-35(32-49)16-18-37)31-48-26-24-47(25-27-48)30-34-10-4-2-5-11-34/h2,4-5,7-8,10-13,15-22,40,42,44,49H,3,6,9,14,23-32H2,1H3,(H,45,50)(H,46,51) |
| InChIKey | OGNFIDLDGWODPI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|