C36H45N3O6 — CID 6672450
N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 6672450) has the molecular formula C36H45N3O6 and a molecular weight of 615.77 g/mol. Its IUPAC name is N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6672450 |
| Molecular Formula | C36H45N3O6 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | N'-hydroxy-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CCCCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C36H45N3O6/c40-25-26-12-14-28(15-13-26)33-22-31(24-39-20-6-1-7-21-39)44-36(45-33)29-18-16-27(17-19-29)32-9-3-2-8-30(32)23-37-34(41)10-4-5-11-35(42)38-43/h2-3,8-9,12-19,31,33,36,40,43H,1,4-7,10-11,20-25H2,(H,37,41)(H,38,42)/t31-,33+,36+/m1/s1 |
| InChIKey | JTYMZMNVPWGUPM-YQZOCMGJSA-N |
| XLogP | 5.56 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|