C37H47N3O7 — CID 6676341
N'-hydroxy-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 6676341) has the molecular formula C37H47N3O7 and a molecular weight of 645.80 g/mol. Its IUPAC name is N'-hydroxy-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6676341 |
| Molecular Formula | C37H47N3O7 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | N'-hydroxy-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CN3CCC[C@H]3CO)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C37H47N3O7/c41-24-26-12-14-28(15-13-26)34-21-32(23-40-20-6-8-31(40)25-42)46-37(47-34)29-18-16-27(17-19-29)33-9-5-4-7-30(33)22-38-35(43)10-2-1-3-11-36(44)39-45/h4-5,7,9,12-19,31-32,34,37,41-42,45H,1-3,6,8,10-11,20-25H2,(H,38,43)(H,39,44)/t31-,32-,34+,37+/m0/s1 |
| InChIKey | OMQCDKXHUPOODF-IZOLSYHTSA-N |
| XLogP | 4.92 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|