C36H45N3O7 — CID 6672750
N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 6672750) has the molecular formula C36H45N3O7 and a molecular weight of 631.77 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6672750 |
| Molecular Formula | C36H45N3O7 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | N'-hydroxy-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1cccc(-c2cccc([C@H]3O[C@@H](CN4CCC[C@H]4CO)C[C@@H](c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C36H45N3O7/c40-23-25-13-15-27(16-14-25)33-20-32(22-39-17-5-10-31(39)24-41)45-36(46-33)30-9-4-8-29(19-30)28-7-3-6-26(18-28)21-37-34(42)11-1-2-12-35(43)38-44/h3-4,6-9,13-16,18-19,31-33,36,40-41,44H,1-2,5,10-12,17,20-24H2,(H,37,42)(H,38,43)/t31-,32+,33-,36-/m0/s1 |
| InChIKey | VOZBOUJQQVDLRR-KUXLGPMISA-N |
| XLogP | 4.53 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|