C35H43N3O7 — CID 3320125
N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 3320125) has the molecular formula C35H43N3O7 and a molecular weight of 617.74 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 3320125 |
| Molecular Formula | C35H43N3O7 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | O=C(CCCC(=O)NCc1cccc(-c2cccc(C3OC(CN4CCCC4CO)CC(c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C35H43N3O7/c39-22-24-12-14-26(15-13-24)32-19-31(21-38-16-4-9-30(38)23-40)44-35(45-32)29-8-2-7-28(18-29)27-6-1-5-25(17-27)20-36-33(41)10-3-11-34(42)37-43/h1-2,5-8,12-15,17-18,30-32,35,39-40,43H,3-4,9-11,16,19-23H2,(H,36,41)(H,37,42) |
| InChIKey | UQGWAPGWYHBJEF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|