C40H52N2O6 — CID 3329777
8-[[2-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 3329777) has the molecular formula C40H52N2O6 and a molecular weight of 656.86 g/mol. Its IUPAC name is 8-[[2-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[2-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 3329777 |
| Molecular Formula | C40H52N2O6 |
| Molecular Weight | 656.86 g/mol |
| Exact Mass | 656.38 |
| IUPAC Name | 8-[[2-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NCc1ccccc1-c1ccc(C2OC(CN3CCCCCCC3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C40H52N2O6/c43-29-30-16-18-32(19-17-30)37-26-35(28-42-24-10-4-1-5-11-25-42)47-40(48-37)33-22-20-31(21-23-33)36-13-9-8-12-34(36)27-41-38(44)14-6-2-3-7-15-39(45)46/h8-9,12-13,16-23,35,37,40,43H,1-7,10-11,14-15,24-29H2,(H,41,44)(H,45,46) |
| InChIKey | KHGNHNBWGQOBIG-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.86 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|