C38H46N2O8 — CID 6677633
6-[[2-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid (PubChem CID 6677633) has the molecular formula C38H46N2O8 and a molecular weight of 658.79 g/mol. Its IUPAC name is 6-[[2-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[2-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6677633 |
| Molecular Formula | C38H46N2O8 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | 6-[[2-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CN3CCC4(CC3)OCCO4)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C38H46N2O8/c41-26-27-9-11-29(12-10-27)34-23-32(25-40-19-17-38(18-20-40)45-21-22-46-38)47-37(48-34)30-15-13-28(14-16-30)33-6-2-1-5-31(33)24-39-35(42)7-3-4-8-36(43)44/h1-2,5-6,9-16,32,34,37,41H,3-4,7-8,17-26H2,(H,39,42)(H,43,44)/t32-,34+,37+/m0/s1 |
| InChIKey | OMQORBROSKFSHY-XNLCPIGASA-N |
| XLogP | 5.49 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|