C40H50N2O8 — CID 6674051
8-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6674051) has the molecular formula C40H50N2O8 and a molecular weight of 686.85 g/mol. Its IUPAC name is 8-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6674051 |
| Molecular Formula | C40H50N2O8 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | 8-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NCc1cccc(-c2cccc([C@H]3O[C@@H](CN4CCC5(CC4)OCCO5)C[C@@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C40H50N2O8/c43-28-29-13-15-31(16-14-29)36-25-35(27-42-19-17-40(18-20-42)47-21-22-48-40)49-39(50-36)34-10-6-9-33(24-34)32-8-5-7-30(23-32)26-41-37(44)11-3-1-2-4-12-38(45)46/h5-10,13-16,23-24,35-36,39,43H,1-4,11-12,17-22,25-28H2,(H,41,44)(H,45,46)/t35-,36+,39+/m1/s1 |
| InChIKey | IPWMREZLRGEQBH-HAMHMQHYSA-N |
| XLogP | 6.27 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|