C40H51N3O8 — CID 3997559
N-[[3-[3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide (PubChem CID 3997559) has the molecular formula C40H51N3O8 and a molecular weight of 701.86 g/mol. Its IUPAC name is N-[[3-[3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[[3-[3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 3997559 |
| Molecular Formula | C40H51N3O8 |
| Molecular Weight | 701.86 g/mol |
| Exact Mass | 701.37 |
| IUPAC Name | N-[[3-[3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1cccc(-c2cccc(C3OC(CN4CCC5(CC4)OCCO5)CC(c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C40H51N3O8/c44-28-29-13-15-31(16-14-29)36-25-35(27-43-19-17-40(18-20-43)48-21-22-49-40)50-39(51-36)34-10-6-9-33(24-34)32-8-5-7-30(23-32)26-41-37(45)11-3-1-2-4-12-38(46)42-47/h5-10,13-16,23-24,35-36,39,44,47H,1-4,11-12,17-22,25-28H2,(H,41,45)(H,42,46) |
| InChIKey | SBYJQZQGPSTHRL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.86 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|