C32H43N3O8 — CID 6677589
N-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide (PubChem CID 6677589) has the molecular formula C32H43N3O8 and a molecular weight of 597.71 g/mol. Its IUPAC name is N-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 6677589 |
| Molecular Formula | C32H43N3O8 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | N-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)Nc1cccc([C@@H]2O[C@H](CN3CCC4(CC3)OCCO4)C[C@H](c3ccc(CO)cc3)O2)c1)NO |
| InChI | InChI=1S/C32H43N3O8/c36-22-23-9-11-24(12-10-23)28-20-27(21-35-15-13-32(14-16-35)40-17-18-41-32)42-31(43-28)25-5-4-6-26(19-25)33-29(37)7-2-1-3-8-30(38)34-39/h4-6,9-12,19,27-28,31,36,39H,1-3,7-8,13-18,20-22H2,(H,33,37)(H,34,38)/t27-,28+,31+/m0/s1 |
| InChIKey | VCGLLRIOFHXHCH-WTNLLYQRSA-N |
| XLogP | 3.96 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|