C31H43N3O6 — CID 6672408
N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6672408) has the molecular formula C31H43N3O6 and a molecular weight of 553.70 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6672408 |
| Molecular Formula | C31H43N3O6 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1cccc([C@H]2O[C@@H](CN3CCCCC3)C[C@@H](c3ccc(CO)cc3)O2)c1)NO |
| InChI | InChI=1S/C31H43N3O6/c35-22-23-13-15-24(16-14-23)28-20-27(21-34-17-6-3-7-18-34)39-31(40-28)25-9-8-10-26(19-25)32-29(36)11-4-1-2-5-12-30(37)33-38/h8-10,13-16,19,27-28,31,35,38H,1-7,11-12,17-18,20-22H2,(H,32,36)(H,33,37)/t27-,28+,31+/m1/s1 |
| InChIKey | YZDTXHDSBWJCPC-XHWIWGEHSA-N |
| XLogP | 4.99 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|