C37H48N4O5 — CID 6672409
N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6672409) has the molecular formula C37H48N4O5 and a molecular weight of 628.81 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6672409 |
| Molecular Formula | C37H48N4O5 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1cccc([C@H]2O[C@@H](CN3CCCCC3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C37H48N4O5/c38-32-13-6-7-14-33(32)40-36(44)16-5-2-1-4-15-35(43)39-30-12-10-11-29(23-30)37-45-31(25-41-21-8-3-9-22-41)24-34(46-37)28-19-17-27(26-42)18-20-28/h6-7,10-14,17-20,23,31,34,37,42H,1-5,8-9,15-16,21-22,24-26,38H2,(H,39,43)(H,40,44)/t31-,34+,37+/m1/s1 |
| InChIKey | JLCBNSSNSJFBTN-UJOJRLIHSA-N |
| XLogP | 6.71 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|