C40H49N7O5 — CID 6678025
N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6678025) has the molecular formula C40H49N7O5 and a molecular weight of 707.88 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6678025 |
| Molecular Formula | C40H49N7O5 |
| Molecular Weight | 707.88 g/mol |
| Exact Mass | 707.38 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1cccc([C@@H]2O[C@H](CN3CCN(c4ncccn4)CC3)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C40H49N7O5/c41-34-11-5-6-12-35(34)45-38(50)14-4-2-1-3-13-37(49)44-32-10-7-9-31(25-32)39-51-33(26-36(52-39)30-17-15-29(28-48)16-18-30)27-46-21-23-47(24-22-46)40-42-19-8-20-43-40/h5-12,15-20,25,33,36,39,48H,1-4,13-14,21-24,26-28,41H2,(H,44,49)(H,45,50)/t33-,36+,39+/m0/s1 |
| InChIKey | BGPYHYPFQQTBKZ-QEZWGBTOSA-N |
| XLogP | 5.84 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.88 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|