C34H37Cl2N5O5 — CID 6677374
N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6677374) has the molecular formula C34H37Cl2N5O5 and a molecular weight of 666.61 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6677374 |
| Molecular Formula | C34H37Cl2N5O5 |
| Molecular Weight | 666.61 g/mol |
| Exact Mass | 665.22 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)Nc1cccc([C@@H]2O[C@H](Cn3cnc(Cl)c3Cl)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C34H37Cl2N5O5/c35-32-33(36)41(21-38-32)19-26-18-29(23-15-13-22(20-42)14-16-23)46-34(45-26)24-7-6-8-25(17-24)39-30(43)11-2-1-3-12-31(44)40-28-10-5-4-9-27(28)37/h4-10,13-17,21,26,29,34,42H,1-3,11-12,18-20,37H2,(H,39,43)(H,40,44)/t26-,29+,34+/m0/s1 |
| InChIKey | SWIFVONEGPFSQV-HVUNFXDMSA-N |
| XLogP | 7.04 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.61 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|