C27H29Cl2N3O6 — CID 3257149
6-[3-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid (PubChem CID 3257149) has the molecular formula C27H29Cl2N3O6 and a molecular weight of 562.45 g/mol. Its IUPAC name is 6-[3-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid.
| Compound Name | 6-[3-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 3257149 |
| Molecular Formula | C27H29Cl2N3O6 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 6-[3-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1cccc(C2OC(Cn3cnc(Cl)c3Cl)CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C27H29Cl2N3O6/c28-25-26(29)32(16-30-25)14-21-13-22(18-10-8-17(15-33)9-11-18)38-27(37-21)19-4-3-5-20(12-19)31-23(34)6-1-2-7-24(35)36/h3-5,8-12,16,21-22,27,33H,1-2,6-7,13-15H2,(H,31,34)(H,35,36) |
| InChIKey | WLBDHWZXIJBKKM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|