C35H37Cl2N3O6 — CID 6673820
7-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid (PubChem CID 6673820) has the molecular formula C35H37Cl2N3O6 and a molecular weight of 666.60 g/mol. Its IUPAC name is 7-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid.
| Compound Name | 7-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6673820 |
| Molecular Formula | C35H37Cl2N3O6 |
| Molecular Weight | 666.60 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | 7-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](Cn3cnc(Cl)c3Cl)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C35H37Cl2N3O6/c36-33-34(37)40(22-39-33)20-28-18-30(25-12-10-23(21-41)11-13-25)46-35(45-28)26-16-14-24(15-17-26)29-7-5-4-6-27(29)19-38-31(42)8-2-1-3-9-32(43)44/h4-7,10-17,22,28,30,35,41H,1-3,8-9,18-21H2,(H,38,42)(H,43,44)/t28-,30+,35+/m1/s1 |
| InChIKey | HXDRIMFRYAVNQB-DKQXMDEESA-N |
| XLogP | 7.25 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|