C35H38Cl2N4O6 — CID 3952198
N-[[2-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide (PubChem CID 3952198) has the molecular formula C35H38Cl2N4O6 and a molecular weight of 681.62 g/mol. Its IUPAC name is N-[[2-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[[2-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 3952198 |
| Molecular Formula | C35H38Cl2N4O6 |
| Molecular Weight | 681.62 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | N-[[2-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccccc1-c1ccc(C2OC(Cn3cnc(Cl)c3Cl)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C35H38Cl2N4O6/c36-33-34(37)41(22-39-33)20-28-18-30(25-12-10-23(21-42)11-13-25)47-35(46-28)26-16-14-24(15-17-26)29-7-5-4-6-27(29)19-38-31(43)8-2-1-3-9-32(44)40-45/h4-7,10-17,22,28,30,35,42,45H,1-3,8-9,18-21H2,(H,38,43)(H,40,44) |
| InChIKey | HXVJEOZRXUWKHO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|