C36H40Cl2N4O6 — CID 6677424
N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide (PubChem CID 6677424) has the molecular formula C36H40Cl2N4O6 and a molecular weight of 695.64 g/mol. Its IUPAC name is N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 6677424 |
| Molecular Formula | C36H40Cl2N4O6 |
| Molecular Weight | 695.64 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](Cn3cnc(Cl)c3Cl)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C36H40Cl2N4O6/c37-34-35(38)42(23-40-34)21-29-19-31(26-13-11-24(22-43)12-14-26)48-36(47-29)27-17-15-25(16-18-27)30-8-6-5-7-28(30)20-39-32(44)9-3-1-2-4-10-33(45)41-46/h5-8,11-18,23,29,31,36,43,46H,1-4,9-10,19-22H2,(H,39,44)(H,41,45)/t29-,31+,36+/m0/s1 |
| InChIKey | RTAJCRUQCRNGNU-QCVXTWCJSA-N |
| XLogP | 7.06 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|