C35H26Cl2F5N3O4 — CID 6700888
N-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6700888) has the molecular formula C35H26Cl2F5N3O4 and a molecular weight of 718.51 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6700888 |
| Molecular Formula | C35H26Cl2F5N3O4 |
| Molecular Weight | 718.51 g/mol |
| Exact Mass | 717.12 |
| IUPAC Name | N-[[2-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NCc1ccccc1-c1ccc([C@H]2O[C@@H](Cn3cnc(Cl)c3Cl)C[C@@H](c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C35H26Cl2F5N3O4/c36-32-33(37)45(17-44-32)15-23-13-25(20-7-5-18(16-46)6-8-20)49-35(48-23)21-11-9-19(10-12-21)24-4-2-1-3-22(24)14-43-34(47)26-27(38)29(40)31(42)30(41)28(26)39/h1-12,17,23,25,35,46H,13-16H2,(H,43,47)/t23-,25+,35+/m1/s1 |
| InChIKey | COEQYSRPKWRREB-POTFCXIKSA-N |
| XLogP | 8.22 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.51 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|