C30H25Cl2N3O5 — CID 6700851
2-[[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6700851) has the molecular formula C30H25Cl2N3O5 and a molecular weight of 578.45 g/mol. Its IUPAC name is 2-[[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6700851 |
| Molecular Formula | C30H25Cl2N3O5 |
| Molecular Weight | 578.45 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 2-[[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc([C@H]2O[C@@H](Cn3cnc(Cl)c3Cl)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C30H25Cl2N3O5/c31-26-27(32)34(17-33-26)15-22-13-25(20-9-7-19(16-36)8-10-20)40-30(39-22)21-11-5-18(6-12-21)14-35-28(37)23-3-1-2-4-24(23)29(35)38/h1-12,17,22,25,30,36H,13-16H2/t22-,25+,30+/m1/s1 |
| InChIKey | UIDJMTMUKKGDFL-ZOTUOOSYSA-N |
| XLogP | 5.72 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|