C41H38N2O5 — CID 4165988
2-[[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 4165988) has the molecular formula C41H38N2O5 and a molecular weight of 638.76 g/mol. Its IUPAC name is 2-[[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4165988 |
| Molecular Formula | C41H38N2O5 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | 2-[[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(C2OC(CN(Cc3ccccc3)Cc3ccccc3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C41H38N2O5/c44-28-32-17-19-33(20-18-32)38-23-35(27-42(24-29-9-3-1-4-10-29)25-30-11-5-2-6-12-30)47-41(48-38)34-21-15-31(16-22-34)26-43-39(45)36-13-7-8-14-37(36)40(43)46/h1-22,35,38,41,44H,23-28H2 |
| InChIKey | FZRIPUYJWGGEQO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|