C43H42N2O6 — CID 6702083
2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6702083) has the molecular formula C43H42N2O6 and a molecular weight of 682.82 g/mol. Its IUPAC name is 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6702083 |
| Molecular Formula | C43H42N2O6 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)O1 |
| InChI | InChI=1S/C43H42N2O6/c1-28(40(47)33-10-4-3-5-11-33)44(2)26-36-24-39(32-17-15-29(27-46)16-18-32)51-43(50-36)34-21-19-31(20-22-34)35-12-8-9-30(23-35)25-45-41(48)37-13-6-7-14-38(37)42(45)49/h3-23,28,36,39-40,43,46-47H,24-27H2,1-2H3/t28-,36+,39-,40-,43-/m0/s1 |
| InChIKey | KLXLCNLAYIBHRP-JDBXYLQCSA-N |
| XLogP | 7.24 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|