C42H44N2O5 — CID 6696469
N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6696469) has the molecular formula C42H44N2O5 and a molecular weight of 656.82 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6696469 |
| Molecular Formula | C42H44N2O5 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)c4ccccc4)c3)cc2)O1 |
| InChI | InChI=1S/C42H44N2O5/c1-29(40(46)34-11-5-3-6-12-34)44(2)27-38-25-39(33-18-16-30(28-45)17-19-33)49-42(48-38)36-22-20-32(21-23-36)37-15-9-10-31(24-37)26-43-41(47)35-13-7-4-8-14-35/h3-24,29,38-40,42,45-46H,25-28H2,1-2H3,(H,43,47)/t29-,38+,39-,40-,42-/m1/s1 |
| InChIKey | NCWUIJBRBFMWLK-RXYISVINSA-N |
| XLogP | 7.38 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |