C37H42N2O5 — CID 6702081
N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6702081) has the molecular formula C37H42N2O5 and a molecular weight of 594.75 g/mol. Its IUPAC name is N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6702081 |
| Molecular Formula | C37H42N2O5 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CN(C)[C@@H](C)[C@H](O)c4ccccc4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C37H42N2O5/c1-25(36(42)31-9-5-4-6-10-31)39(3)23-34-21-35(30-14-12-27(24-40)13-15-30)44-37(43-34)32-18-16-29(17-19-32)33-11-7-8-28(20-33)22-38-26(2)41/h4-20,25,34-37,40,42H,21-24H2,1-3H3,(H,38,41)/t25-,34+,35-,36-,37-/m0/s1 |
| InChIKey | MPLZARUTYUGABS-BCALYQQYSA-N |
| XLogP | 6.08 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |