C43H47N3O5 — CID 6696487
1-benzyl-3-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6696487) has the molecular formula C43H47N3O5 and a molecular weight of 685.87 g/mol. Its IUPAC name is 1-benzyl-3-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6696487 |
| Molecular Formula | C43H47N3O5 |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.35 |
| IUPAC Name | 1-benzyl-3-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)NCc4ccccc4)c3)cc2)O1 |
| InChI | InChI=1S/C43H47N3O5/c1-30(41(48)36-13-7-4-8-14-36)46(2)28-39-25-40(35-18-16-32(29-47)17-19-35)51-42(50-39)37-22-20-34(21-23-37)38-15-9-12-33(24-38)27-45-43(49)44-26-31-10-5-3-6-11-31/h3-24,30,39-42,47-48H,25-29H2,1-2H3,(H2,44,45,49)/t30-,39+,40-,41-,42-/m1/s1 |
| InChIKey | PRDKFMZVEORPQR-OCRUWIJZSA-N |
| XLogP | 7.44 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |