C36H36N2O6 — CID 6701929
2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6701929) has the molecular formula C36H36N2O6 and a molecular weight of 592.69 g/mol. Its IUPAC name is 2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6701929 |
| Molecular Formula | C36H36N2O6 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(N3C(=O)c4ccccc4C3=O)c2)O1 |
| InChI | InChI=1S/C36H36N2O6/c1-23(33(40)26-9-4-3-5-10-26)37(2)21-29-20-32(25-17-15-24(22-39)16-18-25)44-36(43-29)27-11-8-12-28(19-27)38-34(41)30-13-6-7-14-31(30)35(38)42/h3-19,23,29,32-33,36,39-40H,20-22H2,1-2H3/t23-,29-,32+,33-,36+/m1/s1 |
| InChIKey | VYMYXMUMKZAGOC-LGNUJBGLSA-N |
| XLogP | 5.58 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|