C40H36N2O5 — CID 3690107
2-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 3690107) has the molecular formula C40H36N2O5 and a molecular weight of 624.74 g/mol. Its IUPAC name is 2-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3690107 |
| Molecular Formula | C40H36N2O5 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 2-[3-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(C2OC(CN(Cc3ccccc3)Cc3ccccc3)CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C40H36N2O5/c43-27-30-18-20-31(21-19-30)37-23-34(26-41(24-28-10-3-1-4-11-28)25-29-12-5-2-6-13-29)46-40(47-37)32-14-9-15-33(22-32)42-38(44)35-16-7-8-17-36(35)39(42)45/h1-22,34,37,40,43H,23-27H2 |
| InChIKey | AHOPTUAEDYNMDI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|