C34H33Cl3N2O4 — CID 3593305
2,2,2-trichloro-N-[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 3593305) has the molecular formula C34H33Cl3N2O4 and a molecular weight of 640.01 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3593305 |
| Molecular Formula | C34H33Cl3N2O4 |
| Molecular Weight | 640.01 g/mol |
| Exact Mass | 638.15 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | O=C(Nc1ccc(C2OC(CN(Cc3ccccc3)Cc3ccccc3)CC(c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C34H33Cl3N2O4/c35-34(36,37)33(41)38-29-17-15-28(16-18-29)32-42-30(19-31(43-32)27-13-11-26(23-40)12-14-27)22-39(20-24-7-3-1-4-8-24)21-25-9-5-2-6-10-25/h1-18,30-32,40H,19-23H2,(H,38,41) |
| InChIKey | JHKJWYIVYDVVNQ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.01 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|