C44H48N4O5 — CID 6678679
N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6678679) has the molecular formula C44H48N4O5 and a molecular weight of 712.89 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6678679 |
| Molecular Formula | C44H48N4O5 |
| Molecular Weight | 712.89 g/mol |
| Exact Mass | 712.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1ccc([C@@H]2O[C@H](CN(Cc3ccccc3)Cc3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C44H48N4O5/c45-39-15-7-8-16-40(39)47-43(51)18-10-9-17-42(50)46-37-25-23-36(24-26-37)44-52-38(27-41(53-44)35-21-19-34(31-49)20-22-35)30-48(28-32-11-3-1-4-12-32)29-33-13-5-2-6-14-33/h1-8,11-16,19-26,38,41,44,49H,9-10,17-18,27-31,45H2,(H,46,50)(H,47,51)/t38-,41+,44+/m0/s1 |
| InChIKey | FOVPEIKLQYRNDQ-VWAQWAEUSA-N |
| XLogP | 8.15 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.89 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|