C51H54N4O5 — CID 6675115
N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 6675115) has the molecular formula C51H54N4O5 and a molecular weight of 803.02 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6675115 |
| Molecular Formula | C51H54N4O5 |
| Molecular Weight | 803.02 g/mol |
| Exact Mass | 802.41 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN(Cc3ccccc3)Cc3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C51H54N4O5/c52-46-19-9-10-20-47(46)54-50(58)22-12-11-21-49(57)53-32-43-17-7-8-18-45(43)40-27-29-42(30-28-40)51-59-44(31-48(60-51)41-25-23-39(36-56)24-26-41)35-55(33-37-13-3-1-4-14-37)34-38-15-5-2-6-16-38/h1-10,13-20,23-30,44,48,51,56H,11-12,21-22,31-36,52H2,(H,53,57)(H,54,58)/t44-,48+,51+/m1/s1 |
| InChIKey | FMLARPYKUKERIW-OLEKXHSWSA-N |
| XLogP | 9.49 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.02 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|