C43H52N4O5 — CID 6675913
N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 6675913) has the molecular formula C43H52N4O5 and a molecular weight of 704.91 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6675913 |
| Molecular Formula | C43H52N4O5 |
| Molecular Weight | 704.91 g/mol |
| Exact Mass | 704.39 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | C=CCN(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3ccccc3CNC(=O)CCCCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C43H52N4O5/c1-3-26-47(2)29-36-27-40(33-20-18-31(30-48)19-21-33)52-43(51-36)34-24-22-32(23-25-34)37-13-9-8-12-35(37)28-45-41(49)16-6-4-5-7-17-42(50)46-39-15-11-10-14-38(39)44/h3,8-15,18-25,36,40,43,48H,1,4-7,16-17,26-30,44H2,2H3,(H,45,49)(H,46,50)/t36-,40+,43+/m0/s1 |
| InChIKey | WGKVQLRUMAXUPF-UMRZWIEQSA-N |
| XLogP | 7.69 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.91 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|