C40H46N4O5 — CID 3464919
N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 3464919) has the molecular formula C40H46N4O5 and a molecular weight of 662.83 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 3464919 |
| Molecular Formula | C40H46N4O5 |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | C=CCN(C)CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3cccc(CNC(=O)CCCC(=O)Nc4ccccc4N)c3)cc2)O1 |
| InChI | InChI=1S/C40H46N4O5/c1-3-22-44(2)26-34-24-37(31-16-14-28(27-45)15-17-31)49-40(48-34)32-20-18-30(19-21-32)33-9-6-8-29(23-33)25-42-38(46)12-7-13-39(47)43-36-11-5-4-10-35(36)41/h3-6,8-11,14-21,23,34,37,40,45H,1,7,12-13,22,24-27,41H2,2H3,(H,42,46)(H,43,47) |
| InChIKey | BGSXBEXZJMIRBX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|