C45H51N5O5 — CID 3377944
N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 3377944) has the molecular formula C45H51N5O5 and a molecular weight of 741.93 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 3377944 |
| Molecular Formula | C45H51N5O5 |
| Molecular Weight | 741.93 g/mol |
| Exact Mass | 741.39 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | CN(CCc1ccccn1)CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3cccc(CNC(=O)CCCCC(=O)Nc4ccccc4N)c3)cc2)O1 |
| InChI | InChI=1S/C45H51N5O5/c1-50(26-24-38-11-6-7-25-47-38)30-39-28-42(35-18-16-32(31-51)17-19-35)55-45(54-39)36-22-20-34(21-23-36)37-10-8-9-33(27-37)29-48-43(52)14-4-5-15-44(53)49-41-13-3-2-12-40(41)46/h2-3,6-13,16-23,25,27,39,42,45,51H,4-5,14-15,24,26,28-31,46H2,1H3,(H,48,52)(H,49,53) |
| InChIKey | FGLVLZBAPNRPFH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.93 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|