C38H44N4O6 — CID 4315881
N'-hydroxy-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 4315881) has the molecular formula C38H44N4O6 and a molecular weight of 652.79 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-hydroxy-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 4315881 |
| Molecular Formula | C38H44N4O6 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | N'-hydroxy-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | CN(CCc1ccccn1)CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3cccc(CNC(=O)CCCC(=O)NO)c3)cc2)O1 |
| InChI | InChI=1S/C38H44N4O6/c1-42(21-19-33-8-2-3-20-39-33)25-34-23-35(30-13-11-27(26-43)12-14-30)48-38(47-34)31-17-15-29(16-18-31)32-7-4-6-28(22-32)24-40-36(44)9-5-10-37(45)41-46/h2-4,6-8,11-18,20,22,34-35,38,43,46H,5,9-10,19,21,23-26H2,1H3,(H,40,44)(H,41,45) |
| InChIKey | GAYOOECPKVVJLI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|