C32H40N4O6 — CID 4666798
N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 4666798) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 4666798 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | CN(CCc1ccccn1)CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)CCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C32H40N4O6/c1-36(19-17-26-6-4-5-18-33-26)21-28-20-29(24-11-9-23(22-37)10-12-24)42-32(41-28)25-13-15-27(16-14-25)34-30(38)7-2-3-8-31(39)35-40/h4-6,9-16,18,28-29,32,37,40H,2-3,7-8,17,19-22H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | ODPSJAYBNQXXRG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|