C31H38N4O6 — CID 6677451
N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide (PubChem CID 6677451) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide.
| Compound Name | N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 6677451 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
| SMILES | CN(CCc1ccccn1)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C31H38N4O6/c1-35(18-16-25-5-2-3-17-32-25)20-27-19-28(23-10-8-22(21-36)9-11-23)41-31(40-27)24-12-14-26(15-13-24)33-29(37)6-4-7-30(38)34-39/h2-3,5,8-15,17,27-28,31,36,39H,4,6-7,16,18-21H2,1H3,(H,33,37)(H,34,38)/t27-,28+,31+/m0/s1 |
| InChIKey | RCMZQIMEXVOOHE-WTNLLYQRSA-N |
| XLogP | 3.91 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|