C40H49N5O5 — CID 6673849
N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6673849) has the molecular formula C40H49N5O5 and a molecular weight of 679.86 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6673849 |
| Molecular Formula | C40H49N5O5 |
| Molecular Weight | 679.86 g/mol |
| Exact Mass | 679.37 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | CN(CCc1ccccn1)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)CCCCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C40H49N5O5/c1-45(24-22-32-12-8-9-23-42-32)27-34-26-37(30-20-18-29(28-46)19-21-30)50-40(49-34)31-11-10-13-33(25-31)43-38(47)16-4-2-3-5-17-39(48)44-36-15-7-6-14-35(36)41/h6-15,18-21,23,25,34,37,40,46H,2-5,16-17,22,24,26-28,41H2,1H3,(H,43,47)(H,44,48)/t34-,37+,40+/m1/s1 |
| InChIKey | VTPDJYHUVWEIQR-DWSIONMVSA-N |
| XLogP | 6.79 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.86 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|