C40H36F5N3O4 — CID 4606255
2,3,4,5,6-pentafluoro-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 4606255) has the molecular formula C40H36F5N3O4 and a molecular weight of 717.74 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 4606255 |
| Molecular Formula | C40H36F5N3O4 |
| Molecular Weight | 717.74 g/mol |
| Exact Mass | 717.26 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | CN(CCc1ccccn1)CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3cccc(CNC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)cc2)O1 |
| InChI | InChI=1S/C40H36F5N3O4/c1-48(18-16-30-7-2-3-17-46-30)22-31-20-32(27-10-8-24(23-49)9-11-27)52-40(51-31)28-14-12-26(13-15-28)29-6-4-5-25(19-29)21-47-39(50)33-34(41)36(43)38(45)37(44)35(33)42/h2-15,17,19,31-32,40,49H,16,18,20-23H2,1H3,(H,47,50) |
| InChIKey | WDHUEKUOAXNYCZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.74 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|