C40H36F5N3O4 — CID 6700998
2,3,4,5,6-pentafluoro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6700998) has the molecular formula C40H36F5N3O4 and a molecular weight of 717.74 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6700998 |
| Molecular Formula | C40H36F5N3O4 |
| Molecular Weight | 717.74 g/mol |
| Exact Mass | 717.26 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | CN(CCc1ccccn1)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O1 |
| InChI | InChI=1S/C40H36F5N3O4/c1-48(19-17-29-7-4-5-18-46-29)22-30-20-32(26-11-9-24(23-49)10-12-26)52-40(51-30)27-15-13-25(14-16-27)31-8-3-2-6-28(31)21-47-39(50)33-34(41)36(43)38(45)37(44)35(33)42/h2-16,18,30,32,40,49H,17,19-23H2,1H3,(H,47,50)/t30-,32+,40+/m1/s1 |
| InChIKey | QDHYDILREVKJPV-GHMHRPTOSA-N |
| XLogP | 7.59 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.74 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|