C41H37F5N2O6 — CID 4078335
2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 4078335) has the molecular formula C41H37F5N2O6 and a molecular weight of 748.75 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 4078335 |
| Molecular Formula | C41H37F5N2O6 |
| Molecular Weight | 748.75 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | CN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O1)CC(O)c1cccc(O)c1 |
| InChI | InChI=1S/C41H37F5N2O6/c1-48(21-32(51)27-6-4-7-29(50)17-27)20-30-18-33(25-11-9-23(22-49)10-12-25)54-41(53-30)26-15-13-24(14-16-26)31-8-3-2-5-28(31)19-47-40(52)34-35(42)37(44)39(46)38(45)36(34)43/h2-17,30,32-33,41,49-51H,18-22H2,1H3,(H,47,52) |
| InChIKey | IKZPAJCPGZAMGD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.75 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|