C52H72N4O5 — CID 4288744
N'-(2-aminophenyl)-N-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 4288744) has the molecular formula C52H72N4O5 and a molecular weight of 833.17 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 4288744 |
| Molecular Formula | C52H72N4O5 |
| Molecular Weight | 833.17 g/mol |
| Exact Mass | 832.55 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3cccc(CNC(=O)CCCC(=O)Nc4ccccc4N)c3)cc2)O1 |
| InChI | InChI=1S/C52H72N4O5/c1-3-5-7-9-11-15-33-56(34-16-12-10-8-6-4-2)38-46-36-49(43-27-25-40(39-57)26-28-43)61-52(60-46)44-31-29-42(30-32-44)45-20-17-19-41(35-45)37-54-50(58)23-18-24-51(59)55-48-22-14-13-21-47(48)53/h13-14,17,19-22,25-32,35,46,49,52,57H,3-12,15-16,18,23-24,33-34,36-39,53H2,1-2H3,(H,54,58)(H,55,59) |
| InChIKey | CVZIYHQRGJIKKS-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.17 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|