C49H74N4O5 — CID 3945829
N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide (PubChem CID 3945829) has the molecular formula C49H74N4O5 and a molecular weight of 799.15 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 3945829 |
| Molecular Formula | C49H74N4O5 |
| Molecular Weight | 799.15 g/mol |
| Exact Mass | 798.57 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2ccc(CNC(=O)CCCCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C49H74N4O5/c1-3-5-7-9-13-19-33-53(34-20-14-10-8-6-4-2)37-43-35-46(41-29-27-40(38-54)28-30-41)58-49(57-43)42-31-25-39(26-32-42)36-51-47(55)23-15-11-12-16-24-48(56)52-45-22-18-17-21-44(45)50/h17-18,21-22,25-32,43,46,49,54H,3-16,19-20,23-24,33-38,50H2,1-2H3,(H,51,55)(H,52,56) |
| InChIKey | RBKSMUAFIGXNFS-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.15 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|