C41H64N2O6 — CID 6675728
7-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid (PubChem CID 6675728) has the molecular formula C41H64N2O6 and a molecular weight of 680.97 g/mol. Its IUPAC name is 7-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid.
| Compound Name | 7-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6675728 |
| Molecular Formula | C41H64N2O6 |
| Molecular Weight | 680.97 g/mol |
| Exact Mass | 680.48 |
| IUPAC Name | 7-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)CCCCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C41H64N2O6/c1-3-5-7-9-11-16-28-43(29-17-12-10-8-6-4-2)31-37-30-38(34-22-20-33(32-44)21-23-34)49-41(48-37)35-24-26-36(27-25-35)42-39(45)18-14-13-15-19-40(46)47/h20-27,37-38,41,44H,3-19,28-32H2,1-2H3,(H,42,45)(H,46,47)/t37-,38+,41+/m1/s1 |
| InChIKey | WOMLWJROEFNCJW-GWELZFCUSA-N |
| XLogP | 9.72 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.97 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|