C49H72N2O6 — CID 6679367
8-[[2-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6679367) has the molecular formula C49H72N2O6 and a molecular weight of 785.12 g/mol. Its IUPAC name is 8-[[2-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[2-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6679367 |
| Molecular Formula | C49H72N2O6 |
| Molecular Weight | 785.12 g/mol |
| Exact Mass | 784.54 |
| IUPAC Name | 8-[[2-[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3ccccc3CNC(=O)CCCCCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C49H72N2O6/c1-3-5-7-9-13-19-33-51(34-20-14-10-8-6-4-2)37-44-35-46(41-27-25-39(38-52)26-28-41)57-49(56-44)42-31-29-40(30-32-42)45-22-18-17-21-43(45)36-50-47(53)23-15-11-12-16-24-48(54)55/h17-18,21-22,25-32,44,46,49,52H,3-16,19-20,23-24,33-38H2,1-2H3,(H,50,53)(H,54,55)/t44-,46+,49+/m0/s1 |
| InChIKey | RQJIECMEPUSVBB-QBVPVXHLSA-N |
| XLogP | 11.46 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.12 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|