C48H64N2O4 — CID 6703855
N-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6703855) has the molecular formula C48H64N2O4 and a molecular weight of 733.05 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6703855 |
| Molecular Formula | C48H64N2O4 |
| Molecular Weight | 733.05 g/mol |
| Exact Mass | 732.49 |
| IUPAC Name | N-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C48H64N2O4/c1-3-5-7-9-11-18-32-50(33-19-12-10-8-6-4-2)36-44-34-46(40-26-24-38(37-51)25-27-40)54-48(53-44)42-30-28-39(29-31-42)45-23-17-16-22-43(45)35-49-47(52)41-20-14-13-15-21-41/h13-17,20-31,44,46,48,51H,3-12,18-19,32-37H2,1-2H3,(H,49,52)/t44-,46+,48+/m1/s1 |
| InChIKey | FKTAHILNHBSCKO-ZHKLAMKDSA-N |
| XLogP | 11.34 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.05 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|